C11H15FN3O13P3S — CID 122449838
[[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449838) has the molecular formula C11H15FN3O13P3S and a molecular weight of 541.24 g/mol. Its IUPAC name is [[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449838 |
| Molecular Formula | C11H15FN3O13P3S |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 540.95 |
| IUPAC Name | [[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(O)[C@@H](O)[C@@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(N)nc1=S |
| InChI | InChI=1S/C11H15FN3O13P3S/c1-2-10(17)7(16)11(12,26-8(10)15-4-3-6(13)14-9(15)32)5-25-30(21,22)28-31(23,24)27-29(18,19)20/h1,3-4,7-8,16-17H,5H2,(H,21,22)(H,23,24)(H2,13,14,32)(H2,18,19,20)/t7-,8-,10?,11-/m1/s1 |
| InChIKey | CVRNIKVTLHLGBY-ZUCSDGAKSA-N |
| XLogP | -0.54 |
| TPSA | 253.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|