C24H29FN3O8PS — CID 157084771
propan-2-yl (2S)-3-[[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 157084771) has the molecular formula C24H29FN3O8PS and a molecular weight of 569.55 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 157084771 |
| Molecular Formula | C24H29FN3O8PS |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | propan-2-yl (2S)-3-[[(2S,3R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | C#CC1(O)[C@@H](O)[C@@](F)(COP(=O)(C[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc(N)nc1=S |
| InChI | InChI=1S/C24H29FN3O8PS/c1-5-23(31)20(30)24(25,35-21(23)28-12-11-18(26)27-22(28)38)14-33-37(32,36-17-9-7-6-8-10-17)13-16(4)19(29)34-15(2)3/h1,6-12,15-16,20-21,30-31H,13-14H2,2-4H3,(H2,26,27,38)/t16-,20-,21-,23?,24-,37?/m1/s1 |
| InChIKey | HBTWJJFVBKOJBX-LKHQZLARSA-N |
| XLogP | 2.99 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|