C19H24FN4O9P — CID 139343178
(2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 139343178) has the molecular formula C19H24FN4O9P and a molecular weight of 502.39 g/mol. Its IUPAC name is (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 139343178 |
| Molecular Formula | C19H24FN4O9P |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(F)O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H24FN4O9P/c1-11(14(25)26)23-34(30,33-12-6-4-3-5-7-12)31-10-19(20)15(27)18(2,29)16(32-19)24-9-8-13(21)22-17(24)28/h3-9,11,15-16,27,29H,10H2,1-2H3,(H,23,30)(H,25,26)(H2,21,22,28)/t11-,15-,16+,18+,19+,34?/m0/s1 |
| InChIKey | UHIQLPMWGWTPOP-DFXGNUSDSA-N |
| XLogP | 0.40 |
| TPSA | 195.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|