C26H32FN4O8PS — CID 86294270
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate (PubChem CID 86294270) has the molecular formula C26H32FN4O8PS and a molecular weight of 610.60 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 86294270 |
| Molecular Formula | C26H32FN4O8PS |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(F)O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H32FN4O8PS/c1-15(2)37-21(32)16(3)30-40(41,39-19-10-9-17-7-5-6-8-18(17)13-19)36-14-26(27)22(33)25(4,35)23(38-26)31-12-11-20(28)29-24(31)34/h5-13,15-16,22-23,33,35H,14H2,1-4H3,(H,30,41)(H2,28,29,34)/t16-,22-,23+,25+,26+,40?/m0/s1 |
| InChIKey | JDIHDAFEFLDTBM-TYCPOSJASA-N |
| XLogP | 2.54 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|