C26H30F2N3O9PS — CID 118302120
propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate (PubChem CID 118302120) has the molecular formula C26H30F2N3O9PS and a molecular weight of 629.58 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118302120 |
| Molecular Formula | C26H30F2N3O9PS |
| Molecular Weight | 629.58 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(C(F)F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@@H]1O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H30F2N3O9PS/c1-14(2)38-23(35)15(3)30-41(42,40-18-9-8-16-6-4-5-7-17(16)12-18)37-13-26(24(27)28)21(34)20(33)22(39-26)31-11-10-19(32)29-25(31)36/h4-12,14-15,20-22,24,33-34H,13H2,1-3H3,(H,30,42)(H,29,32,36)/t15-,20-,21-,22+,26+,41?/m0/s1 |
| InChIKey | GBQBGQRMVSJNQW-KCSMRDECSA-N |
| XLogP | 2.19 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|