C27H30ClF2N2O9PS — CID 160533716
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate (PubChem CID 160533716) has the molecular formula C27H30ClF2N2O9PS and a molecular weight of 663.03 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 160533716 |
| Molecular Formula | C27H30ClF2N2O9PS |
| Molecular Weight | 663.03 g/mol |
| Exact Mass | 662.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(C(F)F)O[C@@H](N2C=C(Cl)C(=O)CC2=O)[C@H](O)[C@H]1O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H30ClF2N2O9PS/c1-14(2)39-25(37)15(3)31-42(43,41-18-9-8-16-6-4-5-7-17(16)10-18)38-13-27(26(29)30)23(36)22(35)24(40-27)32-12-19(28)20(33)11-21(32)34/h4-10,12,14-15,22-24,26,35-36H,11,13H2,1-3H3,(H,31,43)/t15-,22+,23+,24+,27+,42?/m0/s1 |
| InChIKey | QVWPDQUHQILLQI-PXCNBSJRSA-N |
| XLogP | 3.35 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.03 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|