C26H28ClF3N3O8PS — CID 118302387
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate (PubChem CID 118302387) has the molecular formula C26H28ClF3N3O8PS and a molecular weight of 666.01 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118302387 |
| Molecular Formula | C26H28ClF3N3O8PS |
| Molecular Weight | 666.01 g/mol |
| Exact Mass | 665.10 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-2-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(C(F)F)O[C@@H](n2cc(Cl)c(=O)[nH]c2=O)[C@@H](F)[C@@H]1O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H28ClF3N3O8PS/c1-13(2)39-23(36)14(3)32-42(43,41-17-9-8-15-6-4-5-7-16(15)10-17)38-12-26(24(29)30)20(34)19(28)22(40-26)33-11-18(27)21(35)31-25(33)37/h4-11,13-14,19-20,22,24,34H,12H2,1-3H3,(H,32,43)(H,31,35,37)/t14-,19-,20-,22+,26+,42?/m0/s1 |
| InChIKey | YWWRPWIRICBGIG-BAUZDROUSA-N |
| XLogP | 3.82 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.01 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|