C22H26F4N3O9P — CID 118302564
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-2-(difluoromethyl)-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118302564) has the molecular formula C22H26F4N3O9P and a molecular weight of 583.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-2-(difluoromethyl)-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-2-(difluoromethyl)-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118302564 |
| Molecular Formula | C22H26F4N3O9P |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-2-(difluoromethyl)-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(C(F)F)O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H26F4N3O9P/c1-11(2)36-19(32)12(3)28-39(34,38-13-7-5-4-6-8-13)35-10-22(20(25)26)16(30)15(24)18(37-22)29-9-14(23)17(31)27-21(29)33/h4-9,11-12,15-16,18,20,30H,10H2,1-3H3,(H,28,34)(H,27,31,33)/t12-,15-,16-,18+,22+,39?/m0/s1 |
| InChIKey | YDOKNYCCNSFKAO-JETAFGNOSA-N |
| XLogP | 2.04 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|