C26H29F3N3O9PS — CID 118302315
propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate (PubChem CID 118302315) has the molecular formula C26H29F3N3O9PS and a molecular weight of 647.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118302315 |
| Molecular Formula | C26H29F3N3O9PS |
| Molecular Weight | 647.57 g/mol |
| Exact Mass | 647.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-(difluoromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(C(F)F)O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@H](O)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C26H29F3N3O9PS/c1-13(2)39-23(36)14(3)31-42(43,41-18-10-6-8-15-7-4-5-9-16(15)18)38-12-26(24(28)29)20(34)19(33)22(40-26)32-11-17(27)21(35)30-25(32)37/h4-11,13-14,19-20,22,24,33-34H,12H2,1-3H3,(H,31,43)(H,30,35,37)/t14-,19-,20-,22+,26+,42?/m0/s1 |
| InChIKey | YTICPCHXBYOKOY-BAUZDROUSA-N |
| XLogP | 2.33 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|