C26H31F2N4O9P — CID 118299525
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 118299525) has the molecular formula C26H31F2N4O9P and a molecular weight of 612.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118299525 |
| Molecular Formula | C26H31F2N4O9P |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(C(F)F)O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C26H31F2N4O9P/c1-14(2)39-23(35)15(3)31-42(37,41-18-10-6-8-16-7-4-5-9-17(16)18)38-13-26(24(27)28)21(34)20(33)22(40-26)32-12-11-19(29)30-25(32)36/h4-12,14-15,20-22,24,33-34H,13H2,1-3H3,(H,31,37)(H2,29,30,36)/t15-,20+,21-,22+,26+,42?/m0/s1 |
| InChIKey | GFAODXZTRTWOQN-IRZVLXQDSA-N |
| XLogP | 2.37 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|