C27H31F2N6O8PS — CID 136987320
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate (PubChem CID 136987320) has the molecular formula C27H31F2N6O8PS and a molecular weight of 668.62 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 136987320 |
| Molecular Formula | C27H31F2N6O8PS |
| Molecular Weight | 668.62 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(difluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-2-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(C(F)F)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@H]1O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H31F2N6O8PS/c1-13(2)41-24(39)14(3)34-44(45,43-17-9-8-15-6-4-5-7-16(15)10-17)40-11-27(25(28)29)20(37)19(36)23(42-27)35-12-31-18-21(35)32-26(30)33-22(18)38/h4-10,12-14,19-20,23,25,36-37H,11H2,1-3H3,(H,34,45)(H3,30,32,33,38)/t14-,19+,20+,23+,27+,44?/m0/s1 |
| InChIKey | IURITKVCGLTNGI-RNEAYXSJSA-N |
| XLogP | 2.36 |
| TPSA | 196.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|