C23H26ClF4N2O9P — CID 158946097
propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 158946097) has the molecular formula C23H26ClF4N2O9P and a molecular weight of 616.89 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158946097 |
| Molecular Formula | C23H26ClF4N2O9P |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(5-chloro-2,4-dioxo-1-pyridinyl)-2-(difluoromethyl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(C(F)F)O[C@@H](N2C=C(Cl)C(=O)CC2=O)C(F)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H26ClF4N2O9P/c1-12(2)37-18(33)13(3)29-40(35,39-14-7-5-4-6-8-14)36-11-22(20(25)26)19(34)23(27,28)21(38-22)30-10-15(24)16(31)9-17(30)32/h4-8,10,12-13,19-21,34H,9,11H2,1-3H3,(H,29,35)/t13-,19+,21+,22+,40?/m0/s1 |
| InChIKey | JKVMACHFTCXYMM-QUYOBNQUSA-N |
| XLogP | 3.36 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|