C24H33N2O9P — CID 147989983
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-4-methyl-5-(4-methylidene-2-oxo-1-pyridinyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 147989983) has the molecular formula C24H33N2O9P and a molecular weight of 524.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-4-methyl-5-(4-methylidene-2-oxo-1-pyridinyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-4-methyl-5-(4-methylidene-2-oxo-1-pyridinyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 147989983 |
| Molecular Formula | C24H33N2O9P |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-3,4-dihydroxy-4-methyl-5-(4-methylidene-2-oxo-1-pyridinyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1C=CN([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@]2(C)O)C(=O)C1 |
| InChI | InChI=1S/C24H33N2O9P/c1-15(2)33-22(29)17(4)25-36(31,35-18-9-7-6-8-10-18)32-14-19-21(28)24(5,30)23(34-19)26-12-11-16(3)13-20(26)27/h6-12,15,17,19,21,23,28,30H,3,13-14H2,1-2,4-5H3,(H,25,31)/t17-,19+,21+,23+,24-,36-/m0/s1 |
| InChIKey | IUWOCNBGIAODNB-JYCKGXRISA-N |
| XLogP | 2.26 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|