C31H36FN2O10P — CID 161197480
[(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2-[[[(2S,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3,4-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 161197480) has the molecular formula C31H36FN2O10P and a molecular weight of 646.61 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2-[[[(2S,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3,4-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | [(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2-[[[(2S,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3,4-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 161197480 |
| Molecular Formula | C31H36FN2O10P |
| Molecular Weight | 646.61 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | [(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2-[[[(2S,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3,4-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(F)[C@@H]1C)Oc1ccccc1)C(=O)O[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H36FN2O10P/c1-20-26(43-30(31(20,4)32)34-16-15-24(35)17-27(34)36)19-41-45(39,44-25-13-9-6-10-14-25)33-21(2)28(37)42-22(3)29(38)40-18-23-11-7-5-8-12-23/h5-16,20-22,26,30H,17-19H2,1-4H3,(H,33,39)/t20-,21+,22+,26-,30-,31-,45?/m1/s1 |
| InChIKey | QQRPQSNSQYEQAN-REBQFZPVSA-N |
| XLogP | 4.25 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|