C23H30FN2O8P — CID 58475086
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(3S)-2-methyl-4-oxopentan-3-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyridine-2,4-dione (PubChem CID 58475086) has the molecular formula C23H30FN2O8P and a molecular weight of 512.47 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(3S)-2-methyl-4-oxopentan-3-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(3S)-2-methyl-4-oxopentan-3-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 58475086 |
| Molecular Formula | C23H30FN2O8P |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(3S)-2-methyl-4-oxopentan-3-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyridine-2,4-dione |
| SMILES | CC(=O)[C@@H](NP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H30FN2O8P/c1-14(2)20(15(3)27)25-35(31,34-17-8-6-5-7-9-17)32-13-18-21(30)23(4,24)22(33-18)26-11-10-16(28)12-19(26)29/h5-11,14,18,20-22,30H,12-13H2,1-4H3,(H,25,31)/t18-,20+,21-,22-,23-,35?/m1/s1 |
| InChIKey | CJFCTQJYJCNDOM-KTBOZOAUSA-N |
| XLogP | 2.52 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|