C26H37N2O9PS — CID 159723557
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate (PubChem CID 159723557) has the molecular formula C26H37N2O9PS and a molecular weight of 584.63 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 159723557 |
| Molecular Formula | C26H37N2O9PS |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NP(=S)(OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C26H37N2O9PS/c1-16(2)13-20(24(32)35-17(3)4)27-38(39,37-19-9-7-6-8-10-19)34-15-21-23(31)26(5,33)25(36-21)28-12-11-18(29)14-22(28)30/h6-12,16-17,20-21,23,25,31,33H,13-15H2,1-5H3,(H,27,39)/t20?,21-,23-,25-,26-,38?/m1/s1 |
| InChIKey | AYEYJGMWJOJXSG-QWMZMYJLSA-N |
| XLogP | 2.41 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|