C20H31N2O11PS — CID 90381151
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxy-2-oxoethyl)sulfanylphosphoryl]amino]propanoate (PubChem CID 90381151) has the molecular formula C20H31N2O11PS and a molecular weight of 538.51 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxy-2-oxoethyl)sulfanylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxy-2-oxoethyl)sulfanylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90381151 |
| Molecular Formula | C20H31N2O11PS |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxy-2-oxoethyl)sulfanylphosphoryl]amino]propanoate |
| SMILES | COC(=O)CSP(=O)(NC(C)C(=O)OC(C)C)OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C20H31N2O11PS/c1-11(2)32-18(27)12(3)21-34(29,35-10-16(25)30-5)31-9-14-17(26)20(4,28)19(33-14)22-7-6-13(23)8-15(22)24/h6-7,11-12,14,17,19,26,28H,8-10H2,1-5H3,(H,21,29)/t12?,14-,17-,19-,20-,34?/m1/s1 |
| InChIKey | BBBKEMQMDGVSFV-PBVYWLKXSA-N |
| XLogP | 0.10 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|