C23H30ClN2O8PS — CID 90381150
propan-2-yl 2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenylsulfanylphosphoryl]amino]propanoate (PubChem CID 90381150) has the molecular formula C23H30ClN2O8PS and a molecular weight of 560.99 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenylsulfanylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenylsulfanylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90381150 |
| Molecular Formula | C23H30ClN2O8PS |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenylsulfanylphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(Cl)[C@@H]1O)Sc1ccccc1 |
| InChI | InChI=1S/C23H30ClN2O8PS/c1-14(2)33-21(30)15(3)25-35(31,36-17-8-6-5-7-9-17)32-13-18-20(29)23(4,24)22(34-18)26-11-10-16(27)12-19(26)28/h5-11,14-15,18,20,22,29H,12-13H2,1-4H3,(H,25,31)/t15?,18-,20-,22-,23-,35?/m1/s1 |
| InChIKey | PMVJIOPYNDNJTN-IJNWAVMNSA-N |
| XLogP | 3.23 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|