C18H28ClN2O8P — CID 158524376
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-methylphosphoryl]amino]propanoate (PubChem CID 158524376) has the molecular formula C18H28ClN2O8P and a molecular weight of 466.86 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-methylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-methylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158524376 |
| Molecular Formula | C18H28ClN2O8P |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-methylphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](C)(=O)OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(Cl)[C@@H]1O |
| InChI | InChI=1S/C18H28ClN2O8P/c1-10(2)28-16(25)11(3)20-30(5,26)27-9-13-15(24)18(4,19)17(29-13)21-7-6-12(22)8-14(21)23/h6-7,10-11,13,15,17,24H,8-9H2,1-5H3,(H,20,26)/t11-,13-,15-,17-,18-,30+/m1/s1 |
| InChIKey | HQFPNRVRYVOHMR-VWRGSRSWSA-N |
| XLogP | 1.15 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|