C20H33N2O9PS — CID 90381140
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-propylsulfanylphosphoryl]amino]propanoate (PubChem CID 90381140) has the molecular formula C20H33N2O9PS and a molecular weight of 508.53 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-propylsulfanylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-propylsulfanylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90381140 |
| Molecular Formula | C20H33N2O9PS |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-propylsulfanylphosphoryl]amino]propanoate |
| SMILES | CCCSP(=O)(NC(C)C(=O)OC(C)C)OC[C@H]1O[C@@H](N2C=CC(=O)CC2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C20H33N2O9PS/c1-6-9-33-32(28,21-13(4)18(26)30-12(2)3)29-11-15-17(25)20(5,27)19(31-15)22-8-7-14(23)10-16(22)24/h7-8,12-13,15,17,19,25,27H,6,9-11H2,1-5H3,(H,21,28)/t13?,15-,17-,19-,20-,32?/m1/s1 |
| InChIKey | MOQFVQPNGDHMGJ-QTJQBCKDSA-N |
| XLogP | 1.34 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|