C23H27F4N2O8PS — CID 147817615
propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxo-1-pyridinyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 147817615) has the molecular formula C23H27F4N2O8PS and a molecular weight of 598.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxo-1-pyridinyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxo-1-pyridinyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 147817615 |
| Molecular Formula | C23H27F4N2O8PS |
| Molecular Weight | 598.51 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-2-(difluoromethyl)-5-(2,4-dioxo-1-pyridinyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(C(F)F)O[C@@H](N2C=CC(=O)CC2=O)[C@H](O)C1(F)F)Oc1ccccc1 |
| InChI | InChI=1S/C23H27F4N2O8PS/c1-13(2)35-20(33)14(3)28-38(39,37-16-7-5-4-6-8-16)34-12-22(21(24)25)23(26,27)18(32)19(36-22)29-10-9-15(30)11-17(29)31/h4-10,13-14,18-19,21,32H,11-12H2,1-3H3,(H,28,39)/t14-,18-,19+,22-,38?/m0/s1 |
| InChIKey | HOPTVRVPWVTVTQ-ZAYAUFGZSA-N |
| XLogP | 2.91 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|