C23H30N5O10P — CID 134597176
propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134597176) has the molecular formula C23H30N5O10P and a molecular weight of 567.49 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134597176 |
| Molecular Formula | C23H30N5O10P |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxo-1-pyridinyl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CO[C@]1(CO[P@@](=O)(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@@H](N2C=CC(=O)CC2=O)[C@H](N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C23H30N5O10P/c1-14(2)36-22(32)15(3)26-39(33,38-17-8-6-5-7-9-17)35-13-23(34-4)20(31)19(25-27-24)21(37-23)28-11-10-16(29)12-18(28)30/h5-11,14-15,19-21,31H,12-13H2,1-4H3,(H,26,33)/t15-,19-,20+,21-,23-,39+/m1/s1 |
| InChIKey | CBKGXCKJQQNFSZ-TVTRQEEFSA-N |
| XLogP | 2.17 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|