C25H25F3N5O10P — CID 159577776
2,2,2-trifluoroethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 159577776) has the molecular formula C25H25F3N5O10P and a molecular weight of 643.47 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2,2-trifluoroethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159577776 |
| Molecular Formula | C25H25F3N5O10P |
| Molecular Weight | 643.47 g/mol |
| Exact Mass | 643.13 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](N2C=CC(=O)CC2=O)[C@H](O)[C@@H]1O)Oc1cccc2ccccc12)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C25H25F3N5O10P/c1-14(23(38)40-13-25(26,27)28)30-44(39,43-18-8-4-6-15-5-2-3-7-17(15)18)41-12-24(31-32-29)21(37)20(36)22(42-24)33-10-9-16(34)11-19(33)35/h2-10,14,20-22,36-37H,11-13H2,1H3,(H,30,39)/t14-,20+,21-,22+,24+,44?/m0/s1 |
| InChIKey | MIPXBGCISKOBLY-LVANSGAKSA-N |
| XLogP | 2.83 |
| TPSA | 209.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|