C33H36N5O10P — CID 158107241
benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-4-methylpentanoate (PubChem CID 158107241) has the molecular formula C33H36N5O10P and a molecular weight of 693.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 158107241 |
| Molecular Formula | C33H36N5O10P |
| Molecular Weight | 693.65 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](N2C=CC(=O)CC2=O)[C@H](O)[C@@H]1O)Oc1cccc2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H36N5O10P/c1-21(2)17-26(32(43)45-19-22-9-4-3-5-10-22)35-49(44,48-27-14-8-12-23-11-6-7-13-25(23)27)46-20-33(36-37-34)30(42)29(41)31(47-33)38-16-15-24(39)18-28(38)40/h3-16,21,26,29-31,41-42H,17-20H2,1-2H3,(H,35,44)/t26-,29+,30-,31+,33+,49?/m0/s1 |
| InChIKey | FPZJIDXLOHFMDD-IONVTOEPSA-N |
| XLogP | 4.49 |
| TPSA | 209.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|