C23H32N7O9P — CID 45267431
ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate (PubChem CID 45267431) has the molecular formula C23H32N7O9P and a molecular weight of 581.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 45267431 |
| Molecular Formula | C23H32N7O9P |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H32N7O9P/c1-4-36-21(33)16(12-14(2)3)27-40(35,39-15-8-6-5-7-9-15)37-13-23(28-29-25)19(32)18(31)20(38-23)30-11-10-17(24)26-22(30)34/h5-11,14,16,18-20,31-32H,4,12-13H2,1-3H3,(H,27,35)(H2,24,26,34)/t16-,18+,19-,20+,23+,40?/m0/s1 |
| InChIKey | SEVLVXFTJSEQFI-LJEGCQLHSA-N |
| XLogP | 1.85 |
| TPSA | 233.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|