C20H26N7O9P — CID 45270034
ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-methylamino]acetate (PubChem CID 45270034) has the molecular formula C20H26N7O9P and a molecular weight of 539.44 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-methylamino]acetate.
| Compound Name | ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-methylamino]acetate |
|---|---|
| PubChem CID | 45270034 |
| Molecular Formula | C20H26N7O9P |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)P(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H26N7O9P/c1-3-33-15(28)11-26(2)37(32,36-13-7-5-4-6-8-13)34-12-20(24-25-22)17(30)16(29)18(35-20)27-10-9-14(21)23-19(27)31/h4-10,16-18,29-30H,3,11-12H2,1-2H3,(H2,21,23,31)/t16-,17+,18-,20-,37?/m1/s1 |
| InChIKey | FWBYMGZDESDVAU-TVATUTJMSA-N |
| XLogP | 0.78 |
| TPSA | 224.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|