C10H14N6O5 — CID 23519654
4-amino-1-[(2R,3R,4S,5R)-5-azido-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 23519654) has the molecular formula C10H14N6O5 and a molecular weight of 298.26 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-5-azido-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-5-azido-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 23519654 |
| Molecular Formula | C10H14N6O5 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-5-azido-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CO[C@H]1[C@@H](O)[C@H](n2ccc(N)nc2=O)O[C@@]1(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C10H14N6O5/c1-20-7-6(18)8(21-10(7,4-17)14-15-12)16-3-2-5(11)13-9(16)19/h2-3,6-8,17-18H,4H2,1H3,(H2,11,13,19)/t6-,7+,8-,10-/m1/s1 |
| InChIKey | RVVXXFLMVIZVNS-IBCQBUCCSA-N |
| XLogP | -1.27 |
| TPSA | 168.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|