C15H18N6O8 — CID 58602398
[(2R,3S,4S,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-azidooxolan-2-yl]methyl acetate (PubChem CID 58602398) has the molecular formula C15H18N6O8 and a molecular weight of 410.34 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-azidooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-azidooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58602398 |
| Molecular Formula | C15H18N6O8 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-2-azidooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H18N6O8/c1-7(22)26-6-15(19-20-17)12(28-9(3)24)11(27-8(2)23)13(29-15)21-5-4-10(16)18-14(21)25/h4-5,11-13H,6H2,1-3H3,(H2,16,18,25)/t11-,12-,13+,15+/m0/s1 |
| InChIKey | WRAJIJUJMTWVFN-RMRHIDDWSA-N |
| XLogP | -0.21 |
| TPSA | 197.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|