C30H23ClN6O8 — CID 91041454
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-4-benzoyloxy-2-(benzoyloxymethyl)oxolan-3-yl] 3-chlorobenzoate (PubChem CID 91041454) has the molecular formula C30H23ClN6O8 and a molecular weight of 631.00 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-4-benzoyloxy-2-(benzoyloxymethyl)oxolan-3-yl] 3-chlorobenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-4-benzoyloxy-2-(benzoyloxymethyl)oxolan-3-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 91041454 |
| Molecular Formula | C30H23ClN6O8 |
| Molecular Weight | 631.00 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-4-benzoyloxy-2-(benzoyloxymethyl)oxolan-3-yl] 3-chlorobenzoate |
| SMILES | [N-]=[N+]=N[C@]1(COC(=O)c2ccccc2)O[C@@H](n2ccc(N)nc2=O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C30H23ClN6O8/c31-21-13-7-12-20(16-21)28(40)44-24-23(43-27(39)19-10-5-2-6-11-19)25(37-15-14-22(32)34-29(37)41)45-30(24,35-36-33)17-42-26(38)18-8-3-1-4-9-18/h1-16,23-25H,17H2,(H2,32,34,41)/t23-,24+,25-,30-/m1/s1 |
| InChIKey | WKDDYWVSAFSDDC-FJRSXGRASA-N |
| XLogP | 4.32 |
| TPSA | 197.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|