C30H22ClN4O8S- — CID 165157351
[(2R,4S,5R)-3,4-dibenzoyloxy-2-[(3-chlorobenzoyl)oxymethyl]-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]iminoazanide (PubChem CID 165157351) has the molecular formula C30H22ClN4O8S- and a molecular weight of 634.05 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-dibenzoyloxy-2-[(3-chlorobenzoyl)oxymethyl]-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]iminoazanide.
| Compound Name | [(2R,4S,5R)-3,4-dibenzoyloxy-2-[(3-chlorobenzoyl)oxymethyl]-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]iminoazanide |
|---|---|
| PubChem CID | 165157351 |
| Molecular Formula | C30H22ClN4O8S- |
| Molecular Weight | 634.05 g/mol |
| Exact Mass | 633.09 |
| IUPAC Name | [(2R,4S,5R)-3,4-dibenzoyloxy-2-[(3-chlorobenzoyl)oxymethyl]-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]iminoazanide |
| SMILES | [N-]=N[C@]1(COC(=O)c2cccc(Cl)c2)O[C@@H](n2ccc(=S)[nH]c2=O)[C@@H](OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22ClN4O8S/c31-21-13-7-12-20(16-21)26(36)40-17-30(34-32)24(42-28(38)19-10-5-2-6-11-19)23(41-27(37)18-8-3-1-4-9-18)25(43-30)35-15-14-22(44)33-29(35)39/h1-16,23-25H,17H2,(H,33,39,44)/q-1/t23-,24?,25+,30+/m0/s1 |
| InChIKey | GBFUZLAZOCOWBP-LDIXWDKKSA-N |
| XLogP | 5.11 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.05 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|