C17H16FIN2O5 — CID 90251471
[(2R,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate (PubChem CID 90251471) has the molecular formula C17H16FIN2O5 and a molecular weight of 474.23 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90251471 |
| Molecular Formula | C17H16FIN2O5 |
| Molecular Weight | 474.23 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | [(2R,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
| SMILES | C[C@H]1[C@@H](OC(=O)c2ccccc2)[C@H](n2ccc(=O)[nH]c2=O)O[C@]1(F)CI |
| InChI | InChI=1S/C17H16FIN2O5/c1-10-13(25-15(23)11-5-3-2-4-6-11)14(26-17(10,18)9-19)21-8-7-12(22)20-16(21)24/h2-8,10,13-14H,9H2,1H3,(H,20,22,24)/t10-,13+,14+,17+/m0/s1 |
| InChIKey | ZDNZIDNMWVZRDA-NBCLGQJJSA-N |
| XLogP | 2.03 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|