C24H28N2O9 — CID 58940111
[(1S,6R)-8-(2,4-dioxopyrimidin-1-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate (PubChem CID 58940111) has the molecular formula C24H28N2O9 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(1S,6R)-8-(2,4-dioxopyrimidin-1-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate.
| Compound Name | [(1S,6R)-8-(2,4-dioxopyrimidin-1-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 58940111 |
| Molecular Formula | C24H28N2O9 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(1S,6R)-8-(2,4-dioxopyrimidin-1-yl)-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
| SMILES | CC1(C)OCC2OC(n3ccc(=O)[nH]c3=O)C(OC(=O)c3ccccc3)[C@@H]3OC(C)(C)OC3[C@H]2O1 |
| InChI | InChI=1S/C24H28N2O9/c1-23(2)30-12-14-16(33-23)17-18(35-24(3,4)34-17)19(32-21(28)13-8-6-5-7-9-13)20(31-14)26-11-10-15(27)25-22(26)29/h5-11,14,16-20H,12H2,1-4H3,(H,25,27,29)/t14?,16-,17?,18+,19?,20?/m0/s1 |
| InChIKey | ZJEJHNGICVDHRI-QQSYSGOLSA-N |
| XLogP | 1.33 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |