C17H24N2O8 — CID 58940322
1-[(1S,6S)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]pyrimidine-2,4-dione (PubChem CID 58940322) has the molecular formula C17H24N2O8 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[(1S,6S)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1S,6S)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58940322 |
| Molecular Formula | C17H24N2O8 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[(1S,6S)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)[C@@H]3OC(C)(C)OC3[C@H]2O1 |
| InChI | InChI=1S/C17H24N2O8/c1-16(2)23-7-8-11(25-16)13-12(26-17(3,4)27-13)10(21)14(24-8)19-6-5-9(20)18-15(19)22/h5-6,8,10-14,21H,7H2,1-4H3,(H,18,20,22)/t8?,10?,11-,12-,13?,14?/m0/s1 |
| InChIKey | DXJQKKRMIVVLQN-QQSSIWQUSA-N |
| XLogP | -0.53 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |