C18H26N2O8 — CID 71207043
1-[(1R,8R)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 71207043) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is 1-[(1R,8R)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,8R)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71207043 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[(1R,8R)-7-hydroxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-8-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2OC3COC(C)(C)O[C@H]3C3OC(C)(C)OC3C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H26N2O8/c1-8-6-20(16(23)19-14(8)22)15-10(21)12-13(28-18(4,5)27-12)11-9(25-15)7-24-17(2,3)26-11/h6,9-13,15,21H,7H2,1-5H3,(H,19,22,23)/t9?,10?,11-,12?,13?,15-/m1/s1 |
| InChIKey | QYZPFQCKKRWVRK-JQQWVAJTSA-N |
| XLogP | -0.23 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |