C13H16F2N2O6 — CID 11493711
1-[(4aR,6R,7S,8R,8aR)-8-fluoro-7-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 11493711) has the molecular formula C13H16F2N2O6 and a molecular weight of 334.28 g/mol. Its IUPAC name is 1-[(4aR,6R,7S,8R,8aR)-8-fluoro-7-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7S,8R,8aR)-8-fluoro-7-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11493711 |
| Molecular Formula | C13H16F2N2O6 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[(4aR,6R,7S,8R,8aR)-8-fluoro-7-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC1(C)OC[C@H]2O[C@@H](n3cc(F)c(=O)[nH]c3=O)[C@H](O)[C@@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C13H16F2N2O6/c1-13(2)21-4-6-9(23-13)7(15)8(18)11(22-6)17-3-5(14)10(19)16-12(17)20/h3,6-9,11,18H,4H2,1-2H3,(H,16,19,20)/t6-,7-,8-,9-,11-/m1/s1 |
| InChIKey | YTQHDOZSLLPFKS-UEWQFTGXSA-N |
| XLogP | -0.58 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |