C13H17FN2O7 — CID 102312110
1-[(3aS,4S,6R,7R,7aS)-7-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 102312110) has the molecular formula C13H17FN2O7 and a molecular weight of 332.28 g/mol. Its IUPAC name is 1-[(3aS,4S,6R,7R,7aS)-7-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,4S,6R,7R,7aS)-7-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102312110 |
| Molecular Formula | C13H17FN2O7 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[(3aS,4S,6R,7R,7aS)-7-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](CO)O[C@H](n3cc(F)c(=O)[nH]c3=O)[C@H]2O1 |
| InChI | InChI=1S/C13H17FN2O7/c1-13(2)22-8-7(18)6(4-17)21-11(9(8)23-13)16-3-5(14)10(19)15-12(16)20/h3,6-9,11,17-18H,4H2,1-2H3,(H,15,19,20)/t6-,7-,8+,9+,11+/m1/s1 |
| InChIKey | MLPOCHZKDBWTEH-ABCHNEDTSA-N |
| XLogP | -1.55 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |