C14H19FN2O6 — CID 118444761
1-[(4R,6R,6aS)-2,2-diethyl-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 118444761) has the molecular formula C14H19FN2O6 and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-[(4R,6R,6aS)-2,2-diethyl-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4R,6R,6aS)-2,2-diethyl-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118444761 |
| Molecular Formula | C14H19FN2O6 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[(4R,6R,6aS)-2,2-diethyl-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CCC1(CC)OC2[C@@H](O1)[C@@H](CO)O[C@H]2n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19FN2O6/c1-3-14(4-2)22-9-8(6-18)21-12(10(9)23-14)17-5-7(15)11(19)16-13(17)20/h5,8-10,12,18H,3-4,6H2,1-2H3,(H,16,19,20)/t8-,9+,10?,12-/m1/s1 |
| InChIKey | TVPNUOJUIGMKRT-RXHRYUJKSA-N |
| XLogP | -0.13 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |