C9H11FN2O5 — CID 71315472
1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro(213C,1,3-15N2)pyrimidine-2,4-dione (PubChem CID 71315472) has the molecular formula C9H11FN2O5 and a molecular weight of 249.17 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro(213C,1,3-15N2)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro(213C,1,3-15N2)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71315472 |
| Molecular Formula | C9H11FN2O5 |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro(213C,1,3-15N2)pyrimidine-2,4-dione |
| SMILES | C[C@H]1O[C@@H]([15n]2cc(F)c(=O)[15nH][13c]2=O)C(O)[C@H]1O |
| InChI | InChI=1S/C9H11FN2O5/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16/h2-3,5-6,8,13-14H,1H3,(H,11,15,16)/t3-,5+,6?,8-/m1/s1/i9+1,11+1,12+1 |
| InChIKey | ZWAOHEXOSAUJHY-IOJKMLQVSA-N |
| XLogP | -1.69 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |