C11H13FN2O7 — CID 14530807
[(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 14530807) has the molecular formula C11H13FN2O7 and a molecular weight of 304.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14530807 |
| Molecular Formula | C11H13FN2O7 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H13FN2O7/c1-4(15)20-3-6-7(16)8(17)10(21-6)14-2-5(12)9(18)13-11(14)19/h2,6-8,10,16-17H,3H2,1H3,(H,13,18,19)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | ZZDKBAIZGNCAEU-FDDDBJFASA-N |
| XLogP | -2.14 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |