C15H17FN2O5 — CID 25268665
[(1S,3R,3aR,7aS)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,3a,4,7,7a-hexahydro-2-benzofuran-1-yl]methyl acetate (PubChem CID 25268665) has the molecular formula C15H17FN2O5 and a molecular weight of 324.31 g/mol. Its IUPAC name is [(1S,3R,3aR,7aS)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,3a,4,7,7a-hexahydro-2-benzofuran-1-yl]methyl acetate.
| Compound Name | [(1S,3R,3aR,7aS)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,3a,4,7,7a-hexahydro-2-benzofuran-1-yl]methyl acetate |
|---|---|
| PubChem CID | 25268665 |
| Molecular Formula | C15H17FN2O5 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [(1S,3R,3aR,7aS)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-1,3,3a,4,7,7a-hexahydro-2-benzofuran-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@H]2CC=CC[C@@H]21 |
| InChI | InChI=1S/C15H17FN2O5/c1-8(19)22-7-12-9-4-2-3-5-10(9)14(23-12)18-6-11(16)13(20)17-15(18)21/h2-3,6,9-10,12,14H,4-5,7H2,1H3,(H,17,20,21)/t9-,10+,12+,14+/m0/s1 |
| InChIKey | WSHQCUDIZYSLCT-UZWIWUQPSA-N |
| XLogP | 0.72 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|