C13H20FN2O9P — CID 168664872
butyl [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 168664872) has the molecular formula C13H20FN2O9P and a molecular weight of 398.28 g/mol. Its IUPAC name is butyl [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | butyl [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 168664872 |
| Molecular Formula | C13H20FN2O9P |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | butyl [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CCCCOP(=O)(O)OCC1OC(n2cc(F)c(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C13H20FN2O9P/c1-2-3-4-23-26(21,22)24-6-8-9(17)10(18)12(25-8)16-5-7(14)11(19)15-13(16)20/h5,8-10,12,17-18H,2-4,6H2,1H3,(H,21,22)(H,15,19,20) |
| InChIKey | AUTIIJRQIZOFRS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|