C27H42FN2O8P — CID 70467659
[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] hydrogen phosphate (PubChem CID 70467659) has the molecular formula C27H42FN2O8P and a molecular weight of 572.61 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 70467659 |
| Molecular Formula | C27H42FN2O8P |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | [(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl [(9Z,12Z,15Z)-octadeca-9,12,15-trienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCOP(=O)(O)OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C27H42FN2O8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-36-39(34,35)37-21-24-23(31)19-25(38-24)30-20-22(28)26(32)29-27(30)33/h3-4,6-7,9-10,20,23-25,31H,2,5,8,11-19,21H2,1H3,(H,34,35)(H,29,32,33)/b4-3-,7-6-,10-9-/t23-,24+,25+/m0/s1 |
| InChIKey | BMKOTIPLDWDPSJ-SHNUCVJKSA-N |
| XLogP | 5.05 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|