C15H24FN2O8PS — CID 90045869
[(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 6-sulfanylhexyl hydrogen phosphate (PubChem CID 90045869) has the molecular formula C15H24FN2O8PS and a molecular weight of 442.40 g/mol. Its IUPAC name is [(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 6-sulfanylhexyl hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 6-sulfanylhexyl hydrogen phosphate |
|---|---|
| PubChem CID | 90045869 |
| Molecular Formula | C15H24FN2O8PS |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | [(2R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 6-sulfanylhexyl hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC(O)[C@@H](COP(=O)(O)OCCCCCCS)O2)cc1F |
| InChI | InChI=1S/C15H24FN2O8PS/c16-10-8-18(15(21)17-14(10)20)13-7-11(19)12(26-13)9-25-27(22,23)24-5-3-1-2-4-6-28/h8,11-13,19,28H,1-7,9H2,(H,22,23)(H,17,20,21)/t11?,12-,13-/m1/s1 |
| InChIKey | WTQDLLMENIUEAD-VFRRUGBOSA-N |
| XLogP | 0.95 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|