C10H13N2Na2O9P — CID 91827845
disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate (PubChem CID 91827845) has the molecular formula C10H13N2Na2O9P and a molecular weight of 382.17 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 91827845 |
| Molecular Formula | C10H13N2Na2O9P |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c(=O)[nH]c1=O.[Na+].[Na+] |
| InChI | InChI=1S/C10H15N2O9P.2Na/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(21-9)3-20-22(17,18)19;;/h2,5-7,9,13-14H,3H2,1H3,(H,11,15,16)(H2,17,18,19);;/q;2*+1/p-2/t5-,6-,7-,9-;;/m1../s1 |
| InChIKey | CSZHIUUQGIVPQK-ORXGBHRDSA-L |
| XLogP | -9.68 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | -9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|