C10H14N3O8P-2 — CID 15956515
[(2S,3S,4R,5R)-3-amino-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate (PubChem CID 15956515) has the molecular formula C10H14N3O8P-2 and a molecular weight of 335.21 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3-amino-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | [(2S,3S,4R,5R)-3-amino-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 15956515 |
| Molecular Formula | C10H14N3O8P-2 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | [(2S,3S,4R,5R)-3-amino-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](N)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N3O8P/c1-4-2-13(10(16)12-8(4)15)9-7(14)6(11)5(21-9)3-20-22(17,18)19/h2,5-7,9,14H,3,11H2,1H3,(H,12,15,16)(H2,17,18,19)/p-2/t5-,6-,7-,9-/m1/s1 |
| InChIKey | BOECYGFZFFYWPU-JXOAFFINSA-L |
| XLogP | -3.72 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|