C15H23F2N2O8P — CID 88880807
1-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 88880807) has the molecular formula C15H23F2N2O8P and a molecular weight of 428.33 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88880807 |
| Molecular Formula | C15H23F2N2O8P |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(OCC)C(F)(F)C[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23F2N2O8P/c1-4-25-28(24,26-5-2)15(16,17)6-9-10(20)11(21)13(27-9)19-7-8(3)12(22)18-14(19)23/h7,9-11,13,20-21H,4-6H2,1-3H3,(H,18,22,23)/t9-,10-,11-,13-/m1/s1 |
| InChIKey | ZOCSBDGJGNSNLH-PRULPYPASA-N |
| XLogP | 0.71 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|