C15H23F2N2O5PS — CID 15374601
1-[5-(2-diethoxyphosphoryl-2,2-difluoroethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 15374601) has the molecular formula C15H23F2N2O5PS and a molecular weight of 412.40 g/mol. Its IUPAC name is 1-[5-(2-diethoxyphosphoryl-2,2-difluoroethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[5-(2-diethoxyphosphoryl-2,2-difluoroethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15374601 |
| Molecular Formula | C15H23F2N2O5PS |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-[5-(2-diethoxyphosphoryl-2,2-difluoroethyl)thiolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(OCC)C(F)(F)CC1CCC(n2cc(C)c(=O)[nH]c2=O)S1 |
| InChI | InChI=1S/C15H23F2N2O5PS/c1-4-23-25(22,24-5-2)15(16,17)8-11-6-7-12(26-11)19-9-10(3)13(20)18-14(19)21/h9,11-12H,4-8H2,1-3H3,(H,18,20,21) |
| InChIKey | VEGYIFILXBUDRV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|