C12H18N2O7PS- — CID 140914096
1-[(2R,3S)-3-ethoxy-4-[methoxy(oxido)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 140914096) has the molecular formula C12H18N2O7PS- and a molecular weight of 365.32 g/mol. Its IUPAC name is 1-[(2R,3S)-3-ethoxy-4-[methoxy(oxido)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S)-3-ethoxy-4-[methoxy(oxido)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140914096 |
| Molecular Formula | C12H18N2O7PS- |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-[(2R,3S)-3-ethoxy-4-[methoxy(oxido)phosphinothioyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCO[C@H]1C(OP([O-])(=S)OC)CO[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19N2O7PS/c1-4-19-9-8(21-22(17,23)18-3)6-20-11(9)14-5-7(2)10(15)13-12(14)16/h5,8-9,11H,4,6H2,1-3H3,(H,17,23)(H,13,15,16)/p-1/t8?,9-,11+,22?/m0/s1 |
| InChIKey | XNIWPLMUULXWMI-XODUKPMNSA-M |
| XLogP | -0.60 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|