C16H22N2O7 — CID 10784307
diethyl 2-[(2R,3S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate (PubChem CID 10784307) has the molecular formula C16H22N2O7 and a molecular weight of 354.36 g/mol. Its IUPAC name is diethyl 2-[(2R,3S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(2R,3S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 10784307 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | diethyl 2-[(2R,3S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CCO[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H22N2O7/c1-4-23-14(20)11(15(21)24-5-2)10-6-7-25-13(10)18-8-9(3)12(19)17-16(18)22/h8,10-11,13H,4-7H2,1-3H3,(H,17,19,22)/t10-,13+/m0/s1 |
| InChIKey | SFSLMZGXJMAMEF-GXFFZTMASA-N |
| XLogP | 0.12 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|