C14H20N2O7 — CID 25016386
[(2R,3S,4S,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl butanoate (PubChem CID 25016386) has the molecular formula C14H20N2O7 and a molecular weight of 328.32 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4S,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 25016386 |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2R,3S,4S,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@H](n2cc(C)c(=O)[nH]c2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20N2O7/c1-3-4-9(17)22-6-8-10(18)11(19)13(23-8)16-5-7(2)12(20)15-14(16)21/h5,8,10-11,13,18-19H,3-4,6H2,1-2H3,(H,15,20,21)/t8-,10-,11+,13+/m1/s1 |
| InChIKey | WNJLGNJPMBBKCQ-GOONRYMUSA-N |
| XLogP | -1.19 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |